C21H32O4 — CID 71770260
[(2S)-2-hydroxy-3-phenylmethoxypropyl] undec-10-enoate (PubChem CID 71770260) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-phenylmethoxypropyl] undec-10-enoate.
| Compound Name | [(2S)-2-hydroxy-3-phenylmethoxypropyl] undec-10-enoate |
|---|---|
| PubChem CID | 71770260 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | [(2S)-2-hydroxy-3-phenylmethoxypropyl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OC[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C21H32O4/c1-2-3-4-5-6-7-8-12-15-21(23)25-18-20(22)17-24-16-19-13-10-9-11-14-19/h2,9-11,13-14,20,22H,1,3-8,12,15-18H2/t20-/m0/s1 |
| InChIKey | HNKRLOYLHOOKTD-FQEVSTJZSA-N |
| XLogP | 4.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|