C16H24O4 — CID 83139665
2-tert-butyl-4-hydroxy-5-phenylmethoxypentanoic acid (PubChem CID 83139665) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 2-tert-butyl-4-hydroxy-5-phenylmethoxypentanoic acid.
| Compound Name | 2-tert-butyl-4-hydroxy-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 83139665 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2-tert-butyl-4-hydroxy-5-phenylmethoxypentanoic acid |
| SMILES | CC(C)(C)C(CC(O)COCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H24O4/c1-16(2,3)14(15(18)19)9-13(17)11-20-10-12-7-5-4-6-8-12/h4-8,13-14,17H,9-11H2,1-3H3,(H,18,19) |
| InChIKey | CHZKMASKZAEPBI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |