C23H40O9 — CID 171766048
2-[2-[2-[2-[2-[2-(2,2-dimethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethylbenzene (PubChem CID 171766048) has the molecular formula C23H40O9 and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2,2-dimethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethylbenzene.
| Compound Name | 2-[2-[2-[2-[2-[2-(2,2-dimethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethylbenzene |
|---|---|
| PubChem CID | 171766048 |
| Molecular Formula | C23H40O9 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2,2-dimethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethylbenzene |
| SMILES | COC(COCCOCCOCCOCCOCCOCCOCc1ccccc1)OC |
| InChI | InChI=1S/C23H40O9/c1-24-23(25-2)21-32-19-17-30-15-13-28-11-9-26-8-10-27-12-14-29-16-18-31-20-22-6-4-3-5-7-22/h3-7,23H,8-21H2,1-2H3 |
| InChIKey | MKFZEVFQHDGOJF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|