C16H27NO4 — CID 67080067
(2S)-N-(2,2-dimethoxyethyl)-1-methoxy-4-phenylmethoxybutan-2-amine (PubChem CID 67080067) has the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. Its IUPAC name is (2S)-N-(2,2-dimethoxyethyl)-1-methoxy-4-phenylmethoxybutan-2-amine.
| Compound Name | (2S)-N-(2,2-dimethoxyethyl)-1-methoxy-4-phenylmethoxybutan-2-amine |
|---|---|
| PubChem CID | 67080067 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (2S)-N-(2,2-dimethoxyethyl)-1-methoxy-4-phenylmethoxybutan-2-amine |
| SMILES | COC[C@H](CCOCc1ccccc1)NCC(OC)OC |
| InChI | InChI=1S/C16H27NO4/c1-18-13-15(17-11-16(19-2)20-3)9-10-21-12-14-7-5-4-6-8-14/h4-8,15-17H,9-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | SXIMEOUKRPJUEE-HNNXBMFYSA-N |
| XLogP | 1.82 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|