C19H32O4 — CID 10958304
(5R)-5-(2,2-dimethoxyethyl)-6-methyl-7-phenylmethoxyheptan-2-ol (PubChem CID 10958304) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (5R)-5-(2,2-dimethoxyethyl)-6-methyl-7-phenylmethoxyheptan-2-ol.
| Compound Name | (5R)-5-(2,2-dimethoxyethyl)-6-methyl-7-phenylmethoxyheptan-2-ol |
|---|---|
| PubChem CID | 10958304 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (5R)-5-(2,2-dimethoxyethyl)-6-methyl-7-phenylmethoxyheptan-2-ol |
| SMILES | COC(C[C@@H](CCC(C)O)C(C)COCc1ccccc1)OC |
| InChI | InChI=1S/C19H32O4/c1-15(13-23-14-17-8-6-5-7-9-17)18(11-10-16(2)20)12-19(21-3)22-4/h5-9,15-16,18-20H,10-14H2,1-4H3/t15?,16?,18-/m1/s1 |
| InChIKey | MXNACQPSEHJDMU-LEOMRAHMSA-N |
| XLogP | 3.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|