C21H26O2 — CID 10358052
(Z,1S,5R)-3,5-dimethyl-1-phenyl-6-phenylmethoxyhex-3-en-1-ol (PubChem CID 10358052) has the molecular formula C21H26O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is (Z,1S,5R)-3,5-dimethyl-1-phenyl-6-phenylmethoxyhex-3-en-1-ol.
| Compound Name | (Z,1S,5R)-3,5-dimethyl-1-phenyl-6-phenylmethoxyhex-3-en-1-ol |
|---|---|
| PubChem CID | 10358052 |
| Molecular Formula | C21H26O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (Z,1S,5R)-3,5-dimethyl-1-phenyl-6-phenylmethoxyhex-3-en-1-ol |
| SMILES | C/C(=C/[C@@H](C)COCc1ccccc1)C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H26O2/c1-17(14-21(22)20-11-7-4-8-12-20)13-18(2)15-23-16-19-9-5-3-6-10-19/h3-13,18,21-22H,14-16H2,1-2H3/b17-13-/t18-,21+/m1/s1 |
| InChIKey | MYBJURCWFPRWFO-LDQLGUEGSA-N |
| XLogP | 4.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|