C18H28O5 — CID 10426415
(Z,1S,5R)-6-(methoxymethoxymethoxy)-1-(4-methoxyphenyl)-3,5-dimethylhex-3-en-1-ol (PubChem CID 10426415) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (Z,1S,5R)-6-(methoxymethoxymethoxy)-1-(4-methoxyphenyl)-3,5-dimethylhex-3-en-1-ol.
| Compound Name | (Z,1S,5R)-6-(methoxymethoxymethoxy)-1-(4-methoxyphenyl)-3,5-dimethylhex-3-en-1-ol |
|---|---|
| PubChem CID | 10426415 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (Z,1S,5R)-6-(methoxymethoxymethoxy)-1-(4-methoxyphenyl)-3,5-dimethylhex-3-en-1-ol |
| SMILES | COCOCOC[C@H](C)/C=C(/C)C[C@H](O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H28O5/c1-14(9-15(2)11-22-13-23-12-20-3)10-18(19)16-5-7-17(21-4)8-6-16/h5-9,15,18-19H,10-13H2,1-4H3/b14-9-/t15-,18+/m1/s1 |
| InChIKey | WWDGBJIBPPECOT-IBEYYURGSA-N |
| XLogP | 3.30 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|