C12H14Br2O — CID 124579108
[(2R)-4,4-dibromo-2-methylbut-3-enoxy]methylbenzene (PubChem CID 124579108) has the molecular formula C12H14Br2O and a molecular weight of 334.05 g/mol. Its IUPAC name is [(2R)-4,4-dibromo-2-methylbut-3-enoxy]methylbenzene.
| Compound Name | [(2R)-4,4-dibromo-2-methylbut-3-enoxy]methylbenzene |
|---|---|
| PubChem CID | 124579108 |
| Molecular Formula | C12H14Br2O |
| Molecular Weight | 334.05 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | [(2R)-4,4-dibromo-2-methylbut-3-enoxy]methylbenzene |
| SMILES | C[C@H](C=C(Br)Br)COCc1ccccc1 |
| InChI | InChI=1S/C12H14Br2O/c1-10(7-12(13)14)8-15-9-11-5-3-2-4-6-11/h2-7,10H,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | WGXHVRSCNWISHQ-SNVBAGLBSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.05 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |