About methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene
methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene (PubChem CID 165070743) has the molecular formula C17H32O4
and a molecular weight of 300.44 g/mol. Its IUPAC name is methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene.
Molecular Properties
| Compound Name | methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene |
| PubChem CID | 165070743 |
| Molecular Formula | C17H32O4 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene |
| SMILES | CC(C)COCO.CC(C)COCc1ccccc1.CO |
| InChI | InChI=1S/C11H16O.C5H12O2.CH4O/c1-10(2)8-12-9-11-6-4-3-5-7-11;1-5(2)3-7-4-6;1-2/h3-7,10H,8-9H2,1-2H3;5-6H,3-4H2,1-2H3;2H,1H3 |
| InChIKey | SSDIZAWLAMKYLW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene?
The IUPAC name of methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene (CID 165070743) is methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene.
What is the SMILES notation for methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene?
The canonical SMILES for methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene is CC(C)COCO.CC(C)COCc1ccccc1.CO.
What is the InChIKey of methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene?
The InChIKey is SSDIZAWLAMKYLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O.C5H12O2.CH4O/c1-10(2)8-12-9-11-6-4-3-5-7-11;1-5(2)3-7-4-6;1-2/h3-7,10H,8-9H2,1-2H3;5-6H,3-4H2,1-2H3;2H,1H3.
What are the key properties of methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene?
methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene has a molecular weight of 300.44 g/mol, XLogP of 3.08, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;2-methylpropoxymethanol;2-methylpropoxymethylbenzene is sourced from PubChem (CID 165070743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).