C23H32O3Se — CID 15384864
(2S,3S,4S,6S)-2,7-dimethyl-1-phenylmethoxy-4-phenylselanyloctane-3,6-diol (PubChem CID 15384864) has the molecular formula C23H32O3Se and a molecular weight of 435.47 g/mol. Its IUPAC name is (2S,3S,4S,6S)-2,7-dimethyl-1-phenylmethoxy-4-phenylselanyloctane-3,6-diol.
| Compound Name | (2S,3S,4S,6S)-2,7-dimethyl-1-phenylmethoxy-4-phenylselanyloctane-3,6-diol |
|---|---|
| PubChem CID | 15384864 |
| Molecular Formula | C23H32O3Se |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (2S,3S,4S,6S)-2,7-dimethyl-1-phenylmethoxy-4-phenylselanyloctane-3,6-diol |
| SMILES | CC(C)[C@@H](O)C[C@H]([Se]c1ccccc1)[C@@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C23H32O3Se/c1-17(2)21(24)14-22(27-20-12-8-5-9-13-20)23(25)18(3)15-26-16-19-10-6-4-7-11-19/h4-13,17-18,21-25H,14-16H2,1-3H3/t18-,21-,22-,23-/m0/s1 |
| InChIKey | ZBQWQNHFKWBBDH-QGQQZZQASA-N |
| XLogP | 3.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|