C14H21ClO2 — CID 134934585
(2S,3R)-3-chloro-4,4-dimethyl-1-phenylmethoxypentan-2-ol (PubChem CID 134934585) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is (2S,3R)-3-chloro-4,4-dimethyl-1-phenylmethoxypentan-2-ol.
| Compound Name | (2S,3R)-3-chloro-4,4-dimethyl-1-phenylmethoxypentan-2-ol |
|---|---|
| PubChem CID | 134934585 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (2S,3R)-3-chloro-4,4-dimethyl-1-phenylmethoxypentan-2-ol |
| SMILES | CC(C)(C)[C@@H](Cl)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C14H21ClO2/c1-14(2,3)13(15)12(16)10-17-9-11-7-5-4-6-8-11/h4-8,12-13,16H,9-10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | VVIPYVGTDNPOQB-STQMWFEESA-N |
| XLogP | 3.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|