C16H26O4 — CID 10085190
(2S,3S)-4,4-dimethyl-1-phenylmethoxyheptane-2,3,6-triol (PubChem CID 10085190) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (2S,3S)-4,4-dimethyl-1-phenylmethoxyheptane-2,3,6-triol.
| Compound Name | (2S,3S)-4,4-dimethyl-1-phenylmethoxyheptane-2,3,6-triol |
|---|---|
| PubChem CID | 10085190 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (2S,3S)-4,4-dimethyl-1-phenylmethoxyheptane-2,3,6-triol |
| SMILES | CC(O)CC(C)(C)[C@H](O)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C16H26O4/c1-12(17)9-16(2,3)15(19)14(18)11-20-10-13-7-5-4-6-8-13/h4-8,12,14-15,17-19H,9-11H2,1-3H3/t12?,14-,15+/m0/s1 |
| InChIKey | ZMFVCLOJZOZBHM-JQXSQYPDSA-N |
| XLogP | 1.72 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |