C15H22O3 — CID 13181765
(2S,3R,4R)-3,5-dimethyl-1-phenylmethoxyhex-5-ene-2,4-diol (PubChem CID 13181765) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2S,3R,4R)-3,5-dimethyl-1-phenylmethoxyhex-5-ene-2,4-diol.
| Compound Name | (2S,3R,4R)-3,5-dimethyl-1-phenylmethoxyhex-5-ene-2,4-diol |
|---|---|
| PubChem CID | 13181765 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2S,3R,4R)-3,5-dimethyl-1-phenylmethoxyhex-5-ene-2,4-diol |
| SMILES | C=C(C)[C@H](O)[C@@H](C)[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C15H22O3/c1-11(2)15(17)12(3)14(16)10-18-9-13-7-5-4-6-8-13/h4-8,12,14-17H,1,9-10H2,2-3H3/t12-,14+,15-/m0/s1 |
| InChIKey | CWPBYBVNJMQJCZ-CFVMTHIKSA-N |
| XLogP | 2.14 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|