C19H26O5 — CID 102437861
[(2R,3S,4S)-4-acetyloxy-3,5-dimethyl-1-phenylmethoxyhex-5-en-2-yl] acetate (PubChem CID 102437861) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [(2R,3S,4S)-4-acetyloxy-3,5-dimethyl-1-phenylmethoxyhex-5-en-2-yl] acetate.
| Compound Name | [(2R,3S,4S)-4-acetyloxy-3,5-dimethyl-1-phenylmethoxyhex-5-en-2-yl] acetate |
|---|---|
| PubChem CID | 102437861 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(2R,3S,4S)-4-acetyloxy-3,5-dimethyl-1-phenylmethoxyhex-5-en-2-yl] acetate |
| SMILES | C=C(C)[C@@H](OC(C)=O)[C@H](C)[C@H](COCc1ccccc1)OC(C)=O |
| InChI | InChI=1S/C19H26O5/c1-13(2)19(24-16(5)21)14(3)18(23-15(4)20)12-22-11-17-9-7-6-8-10-17/h6-10,14,18-19H,1,11-12H2,2-5H3/t14-,18+,19-/m1/s1 |
| InChIKey | ZZNMHLZXPWNJIK-MDASCCDHSA-N |
| XLogP | 3.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|