C28H50O7 — CID 102331265
(2R,3R,4S,5S,6R,7R,8R,9R,10S,11S,12R,13R)-2,4,6,8,10,12-hexamethyl-1-phenylmethoxypentadecane-3,5,7,9,11,13-hexol (PubChem CID 102331265) has the molecular formula C28H50O7 and a molecular weight of 498.70 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R,7R,8R,9R,10S,11S,12R,13R)-2,4,6,8,10,12-hexamethyl-1-phenylmethoxypentadecane-3,5,7,9,11,13-hexol.
| Compound Name | (2R,3R,4S,5S,6R,7R,8R,9R,10S,11S,12R,13R)-2,4,6,8,10,12-hexamethyl-1-phenylmethoxypentadecane-3,5,7,9,11,13-hexol |
|---|---|
| PubChem CID | 102331265 |
| Molecular Formula | C28H50O7 |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | (2R,3R,4S,5S,6R,7R,8R,9R,10S,11S,12R,13R)-2,4,6,8,10,12-hexamethyl-1-phenylmethoxypentadecane-3,5,7,9,11,13-hexol |
| SMILES | CC[C@@H](O)[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)[C@H](O)[C@H](C)[C@@H](O)[C@@H](C)[C@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C28H50O7/c1-8-23(29)17(3)25(31)19(5)27(33)21(7)28(34)20(6)26(32)18(4)24(30)16(2)14-35-15-22-12-10-9-11-13-22/h9-13,16-21,23-34H,8,14-15H2,1-7H3/t16-,17-,18+,19+,20-,21-,23-,24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | PLNTUEBOCORJCE-YBVUTJEYSA-N |
| XLogP | 2.60 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |