C20H32O3 — CID 89280220
(5R,6S,7S)-3,3,5,7-tetramethyl-4-methylidene-8-phenylmethoxyoctane-2,6-diol (PubChem CID 89280220) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (5R,6S,7S)-3,3,5,7-tetramethyl-4-methylidene-8-phenylmethoxyoctane-2,6-diol.
| Compound Name | (5R,6S,7S)-3,3,5,7-tetramethyl-4-methylidene-8-phenylmethoxyoctane-2,6-diol |
|---|---|
| PubChem CID | 89280220 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (5R,6S,7S)-3,3,5,7-tetramethyl-4-methylidene-8-phenylmethoxyoctane-2,6-diol |
| SMILES | C=C([C@@H](C)[C@H](O)[C@@H](C)COCc1ccccc1)C(C)(C)C(C)O |
| InChI | InChI=1S/C20H32O3/c1-14(12-23-13-18-10-8-7-9-11-18)19(22)15(2)16(3)20(5,6)17(4)21/h7-11,14-15,17,19,21-22H,3,12-13H2,1-2,4-6H3/t14-,15+,17?,19+/m0/s1 |
| InChIKey | CRIVTKNRCXZIOZ-BRAUTPIHSA-N |
| XLogP | 3.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|