C20H30O4 — CID 25181135
ethyl (5R,6R)-5-hydroxy-4,4,6-trimethyl-3-methylidene-7-phenylmethoxyheptanoate (PubChem CID 25181135) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is ethyl (5R,6R)-5-hydroxy-4,4,6-trimethyl-3-methylidene-7-phenylmethoxyheptanoate.
| Compound Name | ethyl (5R,6R)-5-hydroxy-4,4,6-trimethyl-3-methylidene-7-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 25181135 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | ethyl (5R,6R)-5-hydroxy-4,4,6-trimethyl-3-methylidene-7-phenylmethoxyheptanoate |
| SMILES | C=C(CC(=O)OCC)C(C)(C)[C@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C20H30O4/c1-6-24-18(21)12-16(3)20(4,5)19(22)15(2)13-23-14-17-10-8-7-9-11-17/h7-11,15,19,22H,3,6,12-14H2,1-2,4-5H3/t15-,19-/m1/s1 |
| InChIKey | RTXVGHALQZESNF-DNVCBOLYSA-N |
| XLogP | 3.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|