C21H26O4Se — CID 12069716
methyl (3S,4S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxy-2-phenylselanylpentanoate (PubChem CID 12069716) has the molecular formula C21H26O4Se and a molecular weight of 421.40 g/mol. Its IUPAC name is methyl (3S,4S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxy-2-phenylselanylpentanoate.
| Compound Name | methyl (3S,4S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxy-2-phenylselanylpentanoate |
|---|---|
| PubChem CID | 12069716 |
| Molecular Formula | C21H26O4Se |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | methyl (3S,4S)-3-hydroxy-2,4-dimethyl-5-phenylmethoxy-2-phenylselanylpentanoate |
| SMILES | COC(=O)C(C)([Se]c1ccccc1)[C@@H](O)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C21H26O4Se/c1-16(14-25-15-17-10-6-4-7-11-17)19(22)21(2,20(23)24-3)26-18-12-8-5-9-13-18/h4-13,16,19,22H,14-15H2,1-3H3/t16-,19-,21?/m0/s1 |
| InChIKey | STHHDBUEZGJEJP-ZRAKIVDLSA-N |
| XLogP | 2.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|