C19H30O5 — CID 25178199
ethyl (3R,5R,6R)-3,5-dihydroxy-4,4,6-trimethyl-7-phenylmethoxyheptanoate (PubChem CID 25178199) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is ethyl (3R,5R,6R)-3,5-dihydroxy-4,4,6-trimethyl-7-phenylmethoxyheptanoate.
| Compound Name | ethyl (3R,5R,6R)-3,5-dihydroxy-4,4,6-trimethyl-7-phenylmethoxyheptanoate |
|---|---|
| PubChem CID | 25178199 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | ethyl (3R,5R,6R)-3,5-dihydroxy-4,4,6-trimethyl-7-phenylmethoxyheptanoate |
| SMILES | CCOC(=O)C[C@@H](O)C(C)(C)[C@H](O)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C19H30O5/c1-5-24-17(21)11-16(20)19(3,4)18(22)14(2)12-23-13-15-9-7-6-8-10-15/h6-10,14,16,18,20,22H,5,11-13H2,1-4H3/t14-,16-,18-/m1/s1 |
| InChIKey | HPEMDCMQASVYBU-QGPMSJSTSA-N |
| XLogP | 2.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |