C19H30O7 — CID 10595340
ethyl (2S,3R,4S)-2,3-bis(methoxymethoxy)-4-methyl-5-phenylmethoxypentanoate (PubChem CID 10595340) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is ethyl (2S,3R,4S)-2,3-bis(methoxymethoxy)-4-methyl-5-phenylmethoxypentanoate.
| Compound Name | ethyl (2S,3R,4S)-2,3-bis(methoxymethoxy)-4-methyl-5-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 10595340 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | ethyl (2S,3R,4S)-2,3-bis(methoxymethoxy)-4-methyl-5-phenylmethoxypentanoate |
| SMILES | CCOC(=O)[C@@H](OCOC)[C@H](OCOC)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C19H30O7/c1-5-24-19(20)18(26-14-22-4)17(25-13-21-3)15(2)11-23-12-16-9-7-6-8-10-16/h6-10,15,17-18H,5,11-14H2,1-4H3/t15-,17+,18-/m0/s1 |
| InChIKey | KVZTXOXVKUAVKC-JQHSSLGASA-N |
| XLogP | 2.38 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|