C21H26O3 — CID 12995469
(2S,3R,4S)-2,4-dimethyl-3,5-bis(phenylmethoxy)pentanal (PubChem CID 12995469) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S,3R,4S)-2,4-dimethyl-3,5-bis(phenylmethoxy)pentanal.
| Compound Name | (2S,3R,4S)-2,4-dimethyl-3,5-bis(phenylmethoxy)pentanal |
|---|---|
| PubChem CID | 12995469 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2S,3R,4S)-2,4-dimethyl-3,5-bis(phenylmethoxy)pentanal |
| SMILES | C[C@H](C=O)[C@H](OCc1ccccc1)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C21H26O3/c1-17(13-22)21(24-16-20-11-7-4-8-12-20)18(2)14-23-15-19-9-5-3-6-10-19/h3-13,17-18,21H,14-16H2,1-2H3/t17-,18+,21+/m1/s1 |
| InChIKey | AEOMWHIIQMSPLH-LQWHRVPQSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|