C39H46O5 — CID 166897060
[3-methoxy-1-[2-methyl-1,3-bis(phenylmethoxy)propyl]-2-phenylmethoxyhex-5-enoxy]methylbenzene (PubChem CID 166897060) has the molecular formula C39H46O5 and a molecular weight of 594.79 g/mol. Its IUPAC name is [3-methoxy-1-[2-methyl-1,3-bis(phenylmethoxy)propyl]-2-phenylmethoxyhex-5-enoxy]methylbenzene.
| Compound Name | [3-methoxy-1-[2-methyl-1,3-bis(phenylmethoxy)propyl]-2-phenylmethoxyhex-5-enoxy]methylbenzene |
|---|---|
| PubChem CID | 166897060 |
| Molecular Formula | C39H46O5 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | [3-methoxy-1-[2-methyl-1,3-bis(phenylmethoxy)propyl]-2-phenylmethoxyhex-5-enoxy]methylbenzene |
| SMILES | C=CCC(OC)C(OCc1ccccc1)C(OCc1ccccc1)C(OCc1ccccc1)C(C)COCc1ccccc1 |
| InChI | InChI=1S/C39H46O5/c1-4-17-36(40-3)38(43-29-34-22-13-7-14-23-34)39(44-30-35-24-15-8-16-25-35)37(42-28-33-20-11-6-12-21-33)31(2)26-41-27-32-18-9-5-10-19-32/h4-16,18-25,31,36-39H,1,17,26-30H2,2-3H3 |
| InChIKey | OBDJHHUSBNTCNN-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|