C31H38O4 — CID 54752965
(2S,3S,4S,5S,6S)-2,4,6-trimethyl-3,5,7-tris(phenylmethoxy)heptanal (PubChem CID 54752965) has the molecular formula C31H38O4 and a molecular weight of 474.64 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-2,4,6-trimethyl-3,5,7-tris(phenylmethoxy)heptanal.
| Compound Name | (2S,3S,4S,5S,6S)-2,4,6-trimethyl-3,5,7-tris(phenylmethoxy)heptanal |
|---|---|
| PubChem CID | 54752965 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (2S,3S,4S,5S,6S)-2,4,6-trimethyl-3,5,7-tris(phenylmethoxy)heptanal |
| SMILES | CC(C=O)[C@@H](OCc1ccccc1)[C@@H](C)[C@@H](OCc1ccccc1)[C@@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C31H38O4/c1-24(19-32)30(34-22-28-15-9-5-10-16-28)26(3)31(35-23-29-17-11-6-12-18-29)25(2)20-33-21-27-13-7-4-8-14-27/h4-19,24-26,30-31H,20-23H2,1-3H3/t24?,25-,26+,30+,31-/m0/s1 |
| InChIKey | YEWIFZTUVQQZGB-MNBFUQDPSA-N |
| XLogP | 6.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|