C46H56O5Si — CID 11542185
(2S,3S,4R,5S,6S)-1-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-3,5,7-tris(phenylmethoxy)heptan-2-ol (PubChem CID 11542185) has the molecular formula C46H56O5Si and a molecular weight of 717.04 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-1-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-3,5,7-tris(phenylmethoxy)heptan-2-ol.
| Compound Name | (2S,3S,4R,5S,6S)-1-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-3,5,7-tris(phenylmethoxy)heptan-2-ol |
|---|---|
| PubChem CID | 11542185 |
| Molecular Formula | C46H56O5Si |
| Molecular Weight | 717.04 g/mol |
| Exact Mass | 716.39 |
| IUPAC Name | (2S,3S,4R,5S,6S)-1-[tert-butyl(diphenyl)silyl]oxy-4,6-dimethyl-3,5,7-tris(phenylmethoxy)heptan-2-ol |
| SMILES | C[C@H]([C@@H](OCc1ccccc1)[C@@H](C)COCc1ccccc1)[C@H](OCc1ccccc1)[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C46H56O5Si/c1-36(31-48-32-38-21-11-6-12-22-38)44(49-33-39-23-13-7-14-24-39)37(2)45(50-34-40-25-15-8-16-26-40)43(47)35-51-52(46(3,4)5,41-27-17-9-18-28-41)42-29-19-10-20-30-42/h6-30,36-37,43-45,47H,31-35H2,1-5H3/t36-,37+,43-,44-,45-/m0/s1 |
| InChIKey | KKALVWKYTGHNLN-XRSPAEAASA-N |
| XLogP | 8.58 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.04 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|