C37H40I2N2O4Si — CID 101337444
(2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(2,4-diiodo-1H-imidazol-5-yl)-3,4-bis(phenylmethoxy)butan-2-ol (PubChem CID 101337444) has the molecular formula C37H40I2N2O4Si and a molecular weight of 858.63 g/mol. Its IUPAC name is (2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(2,4-diiodo-1H-imidazol-5-yl)-3,4-bis(phenylmethoxy)butan-2-ol.
| Compound Name | (2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(2,4-diiodo-1H-imidazol-5-yl)-3,4-bis(phenylmethoxy)butan-2-ol |
|---|---|
| PubChem CID | 101337444 |
| Molecular Formula | C37H40I2N2O4Si |
| Molecular Weight | 858.63 g/mol |
| Exact Mass | 858.08 |
| IUPAC Name | (2R,3S,4S)-1-[tert-butyl(diphenyl)silyl]oxy-4-(2,4-diiodo-1H-imidazol-5-yl)-3,4-bis(phenylmethoxy)butan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H](O)[C@H](OCc1ccccc1)[C@@H](OCc1ccccc1)c1[nH]c(I)nc1I)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H40I2N2O4Si/c1-37(2,3)46(29-20-12-6-13-21-29,30-22-14-7-15-23-30)45-26-31(42)33(43-24-27-16-8-4-9-17-27)34(32-35(38)41-36(39)40-32)44-25-28-18-10-5-11-19-28/h4-23,31,33-34,42H,24-26H2,1-3H3,(H,40,41)/t31-,33+,34+/m1/s1 |
| InChIKey | YMEZIWGPIQMBFW-BJJUCXOISA-N |
| XLogP | 7.40 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.63 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|