C31H40O4Si — CID 102309188
(2R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-6-methyl-2-phenylmethoxyheptan-3-one (PubChem CID 102309188) has the molecular formula C31H40O4Si and a molecular weight of 504.74 g/mol. Its IUPAC name is (2R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-6-methyl-2-phenylmethoxyheptan-3-one.
| Compound Name | (2R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-6-methyl-2-phenylmethoxyheptan-3-one |
|---|---|
| PubChem CID | 102309188 |
| Molecular Formula | C31H40O4Si |
| Molecular Weight | 504.74 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | (2R,5R,6S)-7-[tert-butyl(diphenyl)silyl]oxy-5-hydroxy-6-methyl-2-phenylmethoxyheptan-3-one |
| SMILES | C[C@@H](OCc1ccccc1)C(=O)C[C@@H](O)[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H40O4Si/c1-24(29(32)21-30(33)25(2)34-23-26-15-9-6-10-16-26)22-35-36(31(3,4)5,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,24-25,29,32H,21-23H2,1-5H3/t24-,25+,29+/m0/s1 |
| InChIKey | HSPSKSWZTLBFOA-BOCWGRARSA-N |
| XLogP | 5.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.74 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|