C36H46O4Si — CID 24905945
[(3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpent-1-en-3-yl] (3R,4S)-4-methyl-3-phenylmethoxyhex-5-enoate (PubChem CID 24905945) has the molecular formula C36H46O4Si and a molecular weight of 570.85 g/mol. Its IUPAC name is [(3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpent-1-en-3-yl] (3R,4S)-4-methyl-3-phenylmethoxyhex-5-enoate.
| Compound Name | [(3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpent-1-en-3-yl] (3R,4S)-4-methyl-3-phenylmethoxyhex-5-enoate |
|---|---|
| PubChem CID | 24905945 |
| Molecular Formula | C36H46O4Si |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | [(3S,4R)-5-[tert-butyl(diphenyl)silyl]oxy-4-methylpent-1-en-3-yl] (3R,4S)-4-methyl-3-phenylmethoxyhex-5-enoate |
| SMILES | C=C[C@H](OC(=O)C[C@@H](OCc1ccccc1)[C@@H](C)C=C)[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H46O4Si/c1-8-28(3)34(38-27-30-19-13-10-14-20-30)25-35(37)40-33(9-2)29(4)26-39-41(36(5,6)7,31-21-15-11-16-22-31)32-23-17-12-18-24-32/h8-24,28-29,33-34H,1-2,25-27H2,3-7H3/t28-,29+,33-,34+/m0/s1 |
| InChIKey | YFVLSBGQIUIZNW-YVKRFGKHSA-N |
| XLogP | 7.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|