C21H36O3Si — CID 24749437
(2S,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylmethoxyhept-6-en-2-ol (PubChem CID 24749437) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (2S,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylmethoxyhept-6-en-2-ol.
| Compound Name | (2S,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylmethoxyhept-6-en-2-ol |
|---|---|
| PubChem CID | 24749437 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (2S,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylmethoxyhept-6-en-2-ol |
| SMILES | C=C[C@H](C)[C@@H](C[C@H](O)CO[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C21H36O3Si/c1-8-17(2)20(23-15-18-12-10-9-11-13-18)14-19(22)16-24-25(6,7)21(3,4)5/h8-13,17,19-20,22H,1,14-16H2,2-7H3/t17-,19-,20+/m0/s1 |
| InChIKey | DPKKDXRBTLYZQT-YSIASYRMSA-N |
| XLogP | 5.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|