C22H38O3Si — CID 101358520
(2S,4S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylidene-7-phenylmethoxyoctan-4-ol (PubChem CID 101358520) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is (2S,4S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylidene-7-phenylmethoxyoctan-4-ol.
| Compound Name | (2S,4S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylidene-7-phenylmethoxyoctan-4-ol |
|---|---|
| PubChem CID | 101358520 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (2S,4S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-6-methylidene-7-phenylmethoxyoctan-4-ol |
| SMILES | C=C(C[C@H](O)C[C@H](C)O[Si](C)(C)C(C)(C)C)[C@@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C22H38O3Si/c1-17(19(3)24-16-20-12-10-9-11-13-20)14-21(23)15-18(2)25-26(7,8)22(4,5)6/h9-13,18-19,21,23H,1,14-16H2,2-8H3/t18-,19+,21-/m0/s1 |
| InChIKey | VZLRISGTTISYIP-ZVDOUQERSA-N |
| XLogP | 5.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|