C23H38O4Si — CID 25180974
(Z,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxydec-6-enoic acid (PubChem CID 25180974) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (Z,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxydec-6-enoic acid.
| Compound Name | (Z,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxydec-6-enoic acid |
|---|---|
| PubChem CID | 25180974 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (Z,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxydec-6-enoic acid |
| SMILES | CCC/C=C\[C@H](C[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C23H38O4Si/c1-7-8-10-15-20(26-18-19-13-11-9-12-14-19)16-21(17-22(24)25)27-28(5,6)23(2,3)4/h9-15,20-21H,7-8,16-18H2,1-6H3,(H,24,25)/b15-10-/t20-,21-/m1/s1 |
| InChIKey | ZOAINKHKTNMNRL-ZNRMRMJZSA-N |
| XLogP | 6.18 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|