C39H67NO7Si3 — CID 11354661
(3R,5S,6S)-3,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[(2-phenylmethoxybenzoyl)amino]heptanoic acid (PubChem CID 11354661) has the molecular formula C39H67NO7Si3 and a molecular weight of 746.22 g/mol. Its IUPAC name is (3R,5S,6S)-3,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[(2-phenylmethoxybenzoyl)amino]heptanoic acid.
| Compound Name | (3R,5S,6S)-3,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[(2-phenylmethoxybenzoyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 11354661 |
| Molecular Formula | C39H67NO7Si3 |
| Molecular Weight | 746.22 g/mol |
| Exact Mass | 745.42 |
| IUPAC Name | (3R,5S,6S)-3,5,7-tris[[tert-butyl(dimethyl)silyl]oxy]-6-[(2-phenylmethoxybenzoyl)amino]heptanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](NC(=O)c1ccccc1OCc1ccccc1)[C@H](C[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H67NO7Si3/c1-37(2,3)48(10,11)45-28-32(40-36(43)31-23-19-20-24-33(31)44-27-29-21-17-16-18-22-29)34(47-50(14,15)39(7,8)9)25-30(26-35(41)42)46-49(12,13)38(4,5)6/h16-24,30,32,34H,25-28H2,1-15H3,(H,40,43)(H,41,42)/t30-,32+,34+/m1/s1 |
| InChIKey | HJHICWHXUSMPFD-LLISZCHOSA-N |
| XLogP | 10.03 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.22 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|