C27H44O3Si2 — CID 57099550
tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxyphenyl]methoxy]-dimethylsilane (PubChem CID 57099550) has the molecular formula C27H44O3Si2 and a molecular weight of 472.82 g/mol. Its IUPAC name is tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxyphenyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxyphenyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 57099550 |
| Molecular Formula | C27H44O3Si2 |
| Molecular Weight | 472.82 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | tert-butyl-[[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylmethoxyphenyl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cccc(OCc2ccccc2)c1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H44O3Si2/c1-26(2,3)31(7,8)29-20-23-17-14-18-25(28-19-22-15-12-11-13-16-22)24(23)21-30-32(9,10)27(4,5)6/h11-18H,19-21H2,1-10H3 |
| InChIKey | MISZRYBEJDKQEG-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.82 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|