C22H31BrO3Si — CID 76807098
2-bromo-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxyphenyl]ethanol (PubChem CID 76807098) has the molecular formula C22H31BrO3Si and a molecular weight of 451.48 g/mol. Its IUPAC name is 2-bromo-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxyphenyl]ethanol.
| Compound Name | 2-bromo-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxyphenyl]ethanol |
|---|---|
| PubChem CID | 76807098 |
| Molecular Formula | C22H31BrO3Si |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-bromo-1-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxyphenyl]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(C(O)CBr)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H31BrO3Si/c1-22(2,3)27(4,5)26-16-19-13-18(20(24)14-23)11-12-21(19)25-15-17-9-7-6-8-10-17/h6-13,20,24H,14-16H2,1-5H3 |
| InChIKey | AKEMWJKXOZSXNW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|