C28H35BrO3Si — CID 68838926
[1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethoxy]-tert-butyl-dimethylsilane (PubChem CID 68838926) has the molecular formula C28H35BrO3Si and a molecular weight of 527.58 g/mol. Its IUPAC name is [1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 68838926 |
| Molecular Formula | C28H35BrO3Si |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(CBr)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H35BrO3Si/c1-28(2,3)33(4,5)32-27(19-29)24-16-25(30-20-22-12-8-6-9-13-22)18-26(17-24)31-21-23-14-10-7-11-15-23/h6-18,27H,19-21H2,1-5H3 |
| InChIKey | QEYIKUUHTMJILQ-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|