C22H21BrO3 — CID 11640220
1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethanol (PubChem CID 11640220) has the molecular formula C22H21BrO3 and a molecular weight of 413.31 g/mol. Its IUPAC name is 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethanol.
| Compound Name | 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethanol |
|---|---|
| PubChem CID | 11640220 |
| Molecular Formula | C22H21BrO3 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 1-[3,5-bis(phenylmethoxy)phenyl]-2-bromoethanol |
| SMILES | OC(CBr)c1cc(OCc2ccccc2)cc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H21BrO3/c23-14-22(24)19-11-20(25-15-17-7-3-1-4-8-17)13-21(12-19)26-16-18-9-5-2-6-10-18/h1-13,22,24H,14-16H2 |
| InChIKey | KNEIXCFXUQTJQL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|