C22H22O4 — CID 69204493
(3,5-dimethoxyphenyl)-(3-phenylmethoxyphenyl)methanol (PubChem CID 69204493) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(3-phenylmethoxyphenyl)methanol.
| Compound Name | (3,5-dimethoxyphenyl)-(3-phenylmethoxyphenyl)methanol |
|---|---|
| PubChem CID | 69204493 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(3-phenylmethoxyphenyl)methanol |
| SMILES | COc1cc(OC)cc(C(O)c2cccc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C22H22O4/c1-24-20-12-18(13-21(14-20)25-2)22(23)17-9-6-10-19(11-17)26-15-16-7-4-3-5-8-16/h3-14,22-23H,15H2,1-2H3 |
| InChIKey | TXPXOGPKXUQCOA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |