C29H25NO5S — CID 11081611
[1-(benzenesulfonyl)-5-methoxyindol-2-yl]-(3-phenylmethoxyphenyl)methanol (PubChem CID 11081611) has the molecular formula C29H25NO5S and a molecular weight of 499.59 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-5-methoxyindol-2-yl]-(3-phenylmethoxyphenyl)methanol.
| Compound Name | [1-(benzenesulfonyl)-5-methoxyindol-2-yl]-(3-phenylmethoxyphenyl)methanol |
|---|---|
| PubChem CID | 11081611 |
| Molecular Formula | C29H25NO5S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | [1-(benzenesulfonyl)-5-methoxyindol-2-yl]-(3-phenylmethoxyphenyl)methanol |
| SMILES | COc1ccc2c(c1)cc(C(O)c1cccc(OCc3ccccc3)c1)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H25NO5S/c1-34-24-15-16-27-23(18-24)19-28(30(27)36(32,33)26-13-6-3-7-14-26)29(31)22-11-8-12-25(17-22)35-20-21-9-4-2-5-10-21/h2-19,29,31H,20H2,1H3 |
| InChIKey | ZJRYVWCEJYDAMR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |