C23H23NO6S — CID 11247697
1-[1-(benzenesulfonyl)-5-methoxyindol-2-yl]-4,4-dimethoxycyclohexa-2,5-dien-1-ol (PubChem CID 11247697) has the molecular formula C23H23NO6S and a molecular weight of 441.51 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)-5-methoxyindol-2-yl]-4,4-dimethoxycyclohexa-2,5-dien-1-ol.
| Compound Name | 1-[1-(benzenesulfonyl)-5-methoxyindol-2-yl]-4,4-dimethoxycyclohexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 11247697 |
| Molecular Formula | C23H23NO6S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 1-[1-(benzenesulfonyl)-5-methoxyindol-2-yl]-4,4-dimethoxycyclohexa-2,5-dien-1-ol |
| SMILES | COc1ccc2c(c1)cc(C1(O)C=CC(OC)(OC)C=C1)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H23NO6S/c1-28-18-9-10-20-17(15-18)16-21(22(25)11-13-23(29-2,30-3)14-12-22)24(20)31(26,27)19-7-5-4-6-8-19/h4-16,25H,1-3H3 |
| InChIKey | ITANWNJQHMHUJT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|