C29H23NO5S — CID 10929155
[1-(benzenesulfonyl)-5-phenylmethoxyindol-2-yl]-(3-methoxyphenyl)methanone (PubChem CID 10929155) has the molecular formula C29H23NO5S and a molecular weight of 497.57 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-5-phenylmethoxyindol-2-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [1-(benzenesulfonyl)-5-phenylmethoxyindol-2-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 10929155 |
| Molecular Formula | C29H23NO5S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [1-(benzenesulfonyl)-5-phenylmethoxyindol-2-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)c2cc3cc(OCc4ccccc4)ccc3n2S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C29H23NO5S/c1-34-24-12-8-11-22(17-24)29(31)28-19-23-18-25(35-20-21-9-4-2-5-10-21)15-16-27(23)30(28)36(32,33)26-13-6-3-7-14-26/h2-19H,20H2,1H3 |
| InChIKey | YDXKKRDDRQVTBB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |