C24H20ClNO6S — CID 56646601
[1-(benzenesulfonyl)-5-chloroindol-2-yl]-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 56646601) has the molecular formula C24H20ClNO6S and a molecular weight of 485.95 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-5-chloroindol-2-yl]-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | [1-(benzenesulfonyl)-5-chloroindol-2-yl]-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 56646601 |
| Molecular Formula | C24H20ClNO6S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | [1-(benzenesulfonyl)-5-chloroindol-2-yl]-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cc3cc(Cl)ccc3n2S(=O)(=O)c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H20ClNO6S/c1-30-21-13-16(14-22(31-2)24(21)32-3)23(27)20-12-15-11-17(25)9-10-19(15)26(20)33(28,29)18-7-5-4-6-8-18/h4-14H,1-3H3 |
| InChIKey | BZNOZTHFSFBXIO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |