C25H22ClN3O6S — CID 139995200
methyl 2-[3-amino-4-[[1-(benzenesulfonyl)-5-chloroindole-2-carbonyl]amino]phenoxy]propanoate (PubChem CID 139995200) has the molecular formula C25H22ClN3O6S and a molecular weight of 527.99 g/mol. Its IUPAC name is methyl 2-[3-amino-4-[[1-(benzenesulfonyl)-5-chloroindole-2-carbonyl]amino]phenoxy]propanoate.
| Compound Name | methyl 2-[3-amino-4-[[1-(benzenesulfonyl)-5-chloroindole-2-carbonyl]amino]phenoxy]propanoate |
|---|---|
| PubChem CID | 139995200 |
| Molecular Formula | C25H22ClN3O6S |
| Molecular Weight | 527.99 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | methyl 2-[3-amino-4-[[1-(benzenesulfonyl)-5-chloroindole-2-carbonyl]amino]phenoxy]propanoate |
| SMILES | COC(=O)C(C)Oc1ccc(NC(=O)c2cc3cc(Cl)ccc3n2S(=O)(=O)c2ccccc2)c(N)c1 |
| InChI | InChI=1S/C25H22ClN3O6S/c1-15(25(31)34-2)35-18-9-10-21(20(27)14-18)28-24(30)23-13-16-12-17(26)8-11-22(16)29(23)36(32,33)19-6-4-3-5-7-19/h3-15H,27H2,1-2H3,(H,28,30) |
| InChIKey | FCXKYJNUBBBFPE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.99 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|