C18H16ClNO5S — CID 68676184
methyl 2-[[1-(benzenesulfonyl)-5-chloroindol-2-yl]methoxy]acetate (PubChem CID 68676184) has the molecular formula C18H16ClNO5S and a molecular weight of 393.85 g/mol. Its IUPAC name is methyl 2-[[1-(benzenesulfonyl)-5-chloroindol-2-yl]methoxy]acetate.
| Compound Name | methyl 2-[[1-(benzenesulfonyl)-5-chloroindol-2-yl]methoxy]acetate |
|---|---|
| PubChem CID | 68676184 |
| Molecular Formula | C18H16ClNO5S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | methyl 2-[[1-(benzenesulfonyl)-5-chloroindol-2-yl]methoxy]acetate |
| SMILES | COC(=O)COCc1cc2cc(Cl)ccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16ClNO5S/c1-24-18(21)12-25-11-15-10-13-9-14(19)7-8-17(13)20(15)26(22,23)16-5-3-2-4-6-16/h2-10H,11-12H2,1H3 |
| InChIKey | DJAKJQMHDRFHQW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |