C18H17NO4S — CID 68677465
3-[1-(benzenesulfonyl)-5-methylindol-2-yl]propanoic acid (PubChem CID 68677465) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)-5-methylindol-2-yl]propanoic acid.
| Compound Name | 3-[1-(benzenesulfonyl)-5-methylindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 68677465 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-[1-(benzenesulfonyl)-5-methylindol-2-yl]propanoic acid |
| SMILES | Cc1ccc2c(c1)cc(CCC(=O)O)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO4S/c1-13-7-9-17-14(11-13)12-15(8-10-18(20)21)19(17)24(22,23)16-5-3-2-4-6-16/h2-7,9,11-12H,8,10H2,1H3,(H,20,21) |
| InChIKey | FBOQDIXWHWHXTJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |