C19H21NO4S2 — CID 139760341
1-(benzenesulfonyl)-5-ethylsulfonyl-2-propylindole (PubChem CID 139760341) has the molecular formula C19H21NO4S2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-ethylsulfonyl-2-propylindole.
| Compound Name | 1-(benzenesulfonyl)-5-ethylsulfonyl-2-propylindole |
|---|---|
| PubChem CID | 139760341 |
| Molecular Formula | C19H21NO4S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-(benzenesulfonyl)-5-ethylsulfonyl-2-propylindole |
| SMILES | CCCc1cc2cc(S(=O)(=O)CC)ccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4S2/c1-3-8-16-13-15-14-18(25(21,22)4-2)11-12-19(15)20(16)26(23,24)17-9-6-5-7-10-17/h5-7,9-14H,3-4,8H2,1-2H3 |
| InChIKey | JPYGSLDXCGJEQA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |