C32H29F3N2O2S — CID 101493083
N,N-dibenzyl-2-[1-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]ethanamine (PubChem CID 101493083) has the molecular formula C32H29F3N2O2S and a molecular weight of 562.66 g/mol. Its IUPAC name is N,N-dibenzyl-2-[1-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]ethanamine.
| Compound Name | N,N-dibenzyl-2-[1-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]ethanamine |
|---|---|
| PubChem CID | 101493083 |
| Molecular Formula | C32H29F3N2O2S |
| Molecular Weight | 562.66 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | N,N-dibenzyl-2-[1-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]ethanamine |
| SMILES | Cc1ccc(S(=O)(=O)n2c(CCN(Cc3ccccc3)Cc3ccccc3)cc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C32H29F3N2O2S/c1-24-12-15-30(16-13-24)40(38,39)37-29(21-27-20-28(32(33,34)35)14-17-31(27)37)18-19-36(22-25-8-4-2-5-9-25)23-26-10-6-3-7-11-26/h2-17,20-21H,18-19,22-23H2,1H3 |
| InChIKey | VYTUSZDBAKYTAQ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |