C25H22F3NO2S — CID 141293462
2-benzyl-1-(4-propan-2-ylphenyl)sulfonyl-5-(trifluoromethyl)indole (PubChem CID 141293462) has the molecular formula C25H22F3NO2S and a molecular weight of 457.52 g/mol. Its IUPAC name is 2-benzyl-1-(4-propan-2-ylphenyl)sulfonyl-5-(trifluoromethyl)indole.
| Compound Name | 2-benzyl-1-(4-propan-2-ylphenyl)sulfonyl-5-(trifluoromethyl)indole |
|---|---|
| PubChem CID | 141293462 |
| Molecular Formula | C25H22F3NO2S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-benzyl-1-(4-propan-2-ylphenyl)sulfonyl-5-(trifluoromethyl)indole |
| SMILES | CC(C)c1ccc(S(=O)(=O)n2c(Cc3ccccc3)cc3cc(C(F)(F)F)ccc32)cc1 |
| InChI | InChI=1S/C25H22F3NO2S/c1-17(2)19-8-11-23(12-9-19)32(30,31)29-22(14-18-6-4-3-5-7-18)16-20-15-21(25(26,27)28)10-13-24(20)29/h3-13,15-17H,14H2,1-2H3 |
| InChIKey | AXBNVLZTGRNGDE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |