C23H24F3NO4S — CID 44600156
methyl 4-[1-(3-propan-2-ylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]butanoate (PubChem CID 44600156) has the molecular formula C23H24F3NO4S and a molecular weight of 467.51 g/mol. Its IUPAC name is methyl 4-[1-(3-propan-2-ylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]butanoate.
| Compound Name | methyl 4-[1-(3-propan-2-ylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]butanoate |
|---|---|
| PubChem CID | 44600156 |
| Molecular Formula | C23H24F3NO4S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | methyl 4-[1-(3-propan-2-ylphenyl)sulfonyl-5-(trifluoromethyl)indol-2-yl]butanoate |
| SMILES | COC(=O)CCCc1cc2cc(C(F)(F)F)ccc2n1S(=O)(=O)c1cccc(C(C)C)c1 |
| InChI | InChI=1S/C23H24F3NO4S/c1-15(2)16-6-4-8-20(14-16)32(29,30)27-19(7-5-9-22(28)31-3)13-17-12-18(23(24,25)26)10-11-21(17)27/h4,6,8,10-15H,5,7,9H2,1-3H3 |
| InChIKey | DQOXQZZWUYZNJE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |