C18H16ClFN2O4S — CID 141163481
methyl 4-[5-chloro-1-(3-fluorophenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate (PubChem CID 141163481) has the molecular formula C18H16ClFN2O4S and a molecular weight of 410.85 g/mol. Its IUPAC name is methyl 4-[5-chloro-1-(3-fluorophenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate.
| Compound Name | methyl 4-[5-chloro-1-(3-fluorophenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate |
|---|---|
| PubChem CID | 141163481 |
| Molecular Formula | C18H16ClFN2O4S |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | methyl 4-[5-chloro-1-(3-fluorophenyl)sulfonylpyrrolo[3,2-b]pyridin-2-yl]butanoate |
| SMILES | COC(=O)CCCc1cc2nc(Cl)ccc2n1S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H16ClFN2O4S/c1-26-18(23)7-3-5-13-11-15-16(8-9-17(19)21-15)22(13)27(24,25)14-6-2-4-12(20)10-14/h2,4,6,8-11H,3,5,7H2,1H3 |
| InChIKey | QVTCPQZBJIYGCH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|