C16H12ClN2NaO4S — CID 141163484
sodium 3-[1-(benzenesulfonyl)-5-chloropyrrolo[3,2-b]pyridin-2-yl]propanoate (PubChem CID 141163484) has the molecular formula C16H12ClN2NaO4S and a molecular weight of 386.79 g/mol. Its IUPAC name is sodium 3-[1-(benzenesulfonyl)-5-chloropyrrolo[3,2-b]pyridin-2-yl]propanoate.
| Compound Name | sodium 3-[1-(benzenesulfonyl)-5-chloropyrrolo[3,2-b]pyridin-2-yl]propanoate |
|---|---|
| PubChem CID | 141163484 |
| Molecular Formula | C16H12ClN2NaO4S |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | sodium 3-[1-(benzenesulfonyl)-5-chloropyrrolo[3,2-b]pyridin-2-yl]propanoate |
| SMILES | O=C([O-])CCc1cc2nc(Cl)ccc2n1S(=O)(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C16H13ClN2O4S.Na/c17-15-8-7-14-13(18-15)10-11(6-9-16(20)21)19(14)24(22,23)12-4-2-1-3-5-12;/h1-5,7-8,10H,6,9H2,(H,20,21);/q;+1/p-1 |
| InChIKey | HMMKEDNZZXJPMX-UHFFFAOYSA-M |
| XLogP | -1.39 |
| TPSA | 92.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|