C19H17ClN4O4S — CID 20680630
(3S)-1-[[1-(benzenesulfonyl)-5-chloropyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxopyrrolidine-3-carboxamide (PubChem CID 20680630) has the molecular formula C19H17ClN4O4S and a molecular weight of 432.89 g/mol. Its IUPAC name is (3S)-1-[[1-(benzenesulfonyl)-5-chloropyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[[1-(benzenesulfonyl)-5-chloropyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 20680630 |
| Molecular Formula | C19H17ClN4O4S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | (3S)-1-[[1-(benzenesulfonyl)-5-chloropyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)[C@@H]1CCN(Cc2cc3nc(Cl)ccc3n2S(=O)(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17ClN4O4S/c20-17-7-6-16-15(22-17)10-12(11-23-9-8-14(18(21)25)19(23)26)24(16)29(27,28)13-4-2-1-3-5-13/h1-7,10,14H,8-9,11H2,(H2,21,25)/t14-/m0/s1 |
| InChIKey | WYZQMQCLUJEVQG-AWEZNQCLSA-N |
| XLogP | 1.76 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|